Identifikatoren & physikalische Daten
| CAS No. | 107392-76-7 |
|---|
| Summenformel | C12H11N3O2 |
|---|
| Durchschnittliche Molmasse | 229,23 g/mol |
|---|
| Monoisotopische Masse | 229,0851266 g/mol |
|---|
| SMILES | O=[N+]([O-])c1ccc(-c2cn3c(n2)CCC3)cc1 |
|---|
| InChIKey | YJEUKSXNJPGTOE-UHFFFAOYSA-N |
|---|
| PubChem CID | 910705 |
|---|
| ChEMBL | CHEMBL1603668 |
|---|
| DTXSID | DTXSID201201528 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|
| Polarare Oberfläche (TPSA) | 63,6 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 1 |
|---|
| Schwere Atome | 17 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 297 |
|---|
| Löslichkeit | 25.5 [ug/mL] (The mean of the results at pH 7.4) |
|---|
