HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Hydroxy-4-methoxyzimtsure
ISOFERULIC ACID · (E)-3-(3-hydroxy-4-Methoxyphenyl)acrylic acid · Isoferulic · Isoferulate · HESPERETIC ACID · 3-Hydroxy-4-MethoxycinnaMic Acid (Isoferulic acid) · Hesperetate · Isoferulic Aci
Identifikatoren & physikalische Daten
| CAS No. | 537-73-5 |
|---|---|
| Summenformel | C10H10O4 |
| Durchschnittliche Molmasse | 194,18 g/mol |
| Monoisotopische Masse | 194,0579088 g/mol |
| SMILES | COc1ccc(C=CC(=O)O)cc1O |
| InChIKey | QURCVMIEKCOAJU-UHFFFAOYSA-N |
| PubChem CID | 92126 |
| ChEBI | CHEBI:189424 |
| DTXSID | DTXSID80862148 |
| Lokaler Name | 3-Hydroxy-4-methoxyzimtsure |
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 66,8 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 3 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 224 |
| Collision Cross Section | 129.74 Ų [M+H-H2O]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| Schmelzpunkt | 230 °C (dec.)(lit.) |
| Siedepunkt | 250.62°C (rough estimate) |
| Dichte | 1.0583 (rough estimate) |
| Brechungsindex | 1.5168 (estimate) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | Soluble in ethanol and methanol. |
| pKa (Säurekonstante) | 4.53±0.10(Predicted) |
| Aggregatzustand | Solid |
| Farbe | Pale Yellow |
| BRN | 2212760 |
| InChI | InChI=1S/C10H10O4/c1-14-9-4-2-7(6-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13) |
| InChIKey | QURCVMIEKCOAJU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C=CC1=CC=C(OC)C(O)=C1 |
| LogP (Verteilungskoeffizient) | 0.788 (est) |
| CAS Datenbank | 537-73-5(CAS DataBase Reference) |
| NIST chemische Informationen | Cinnamic acid, 3-hydroxy-4-methoxy-(537-73-5) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 2 |
|---|---|
| Zollcode | 29189090 |
| RTECS-Nr. | UD3365400 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-37/39-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
3-Hydroxy-4-methoxycinnamic Acid (Isoferulic acid) is a hypoglycemic agent.