(17β)-Hydroxyandrost-4-en-3-onacetat
skf5647 · SKF 5647 · Amolisin · Test Ace · Farmatest · NSC523836 · DEPOSTERON · androtesta
Identifikatoren & physikalische Daten
| CAS No. | 1045-69-8 |
|---|---|
| Summenformel | C21H30O3 |
| Durchschnittliche Molmasse | 330,5 g/mol |
| Monoisotopische Masse | 330,21949482 g/mol |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChIKey | DJPZSBANTAQNFN-PXQJOHHUSA-N |
| PubChem CID | 92145 |
| ChEMBL | CHEMBL488762 |
| ChEBI | CHEBI:16524 |
| EC No. | 213-876-6 |
| DTXSID | DTXSID80909007 |
| Lokaler Name | (17β)-Hydroxyandrost-4-en-3-onacetat |
Chemische & physikalische Eigenschaften
| XLogP | 3,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 43,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 606 |
| Lipide | Lipids -> Sterol Lipids [ST] -> Steroids [ST02] -> C19 steroids (androgens) and derivatives [ST0202] |
| SpringerMaterials Properties | Crystal structure |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 139-141 °C |
| Siedepunkt | 427.89°C (rough estimate) |
| Dichte | 1.0234 (rough estimate) |
| Brechungsindex | 1.6000 (estimate) |
| Flammpunkt | 2℃ |
| Lagerbedingungen | Controlled Substance, -20°C Freezer |
| Löslichkeit | Acetonitrile: 1 mg/mlEthanol: 1 mg/mlMethanol: 1 mg/ml2.35mg/L(25 ºC) |
| Aggregatzustand | A crystalline solid |
| Merck | 13,9255 |
| InChI | InChI=1/C21H30O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h12,16-19H,4-11H2,1-3H3/t16-,17-,18-,19-,20-,21-/s3 |
| InChIKey | DJPZSBANTAQNFN-PXQJOHHUSA-N |
| SMILES | [C@]12([H])CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)CC[C@]21C)OC(=O)C |&1:0,4,6,9,11,21,r| |
| CAS Datenbank | 1045-69-8(CAS DataBase Reference) |
| NIST chemische Informationen | Androst-4-en-3-one, 17-(acetyloxy)-, (17«beta»)-(1045-69-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P264, P270, P280, P301+P317, P318, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2811 6.1/PG 2 |
| RTECS-Nr. | XA3061500 |
| R-Sätze (R) | 45-22-63-36-20/21/22-11 |
| Gefahrensymbole | T,Xn,F |
| Sicherheitshinweise (S) | 53-22-26-36-36/37-16 |
Anwendungen & Verwendung
Beschreibung
Testosterone acetate is an analytical reference standard categorized as an anabolic androgenic steroid. It is an ester of the naturally occurring androgen, testosterone. Testosterone acetate is regulated as a Schedule III compound in the United States. This product is intended for research and forensic applications.
Verwenden
Testosterone Acetate is a Controlled substance that is less popular due to Acetate solution, which is aqueous solution, instead of oil solution as other esterified versions of testosterone that is offering much longer half life. It does not have any medical uses when it comes with Acetate ester. However, taken in consideration that it works in the same way as any other esterified testosterone, it can be used for the same purposes as the esterified testosterones.