HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Fenoprop-methyl
TP Methyl est · Fenoprop-methy · Fenoprop-methyl · Silvex methyl ester · 2,4,5-TP-METHYL ESTER · FENOPROP-METHYL ESTER · Silvex(R) methyl ester · Chlorpyrifos Impurity 54
Identifikatoren & physikalische Daten
| CAS No. | 4841-20-7 |
|---|---|
| Summenformel | C10H9Cl3O3 |
| Durchschnittliche Molmasse | 283,5 g/mol |
| Monoisotopische Masse | 281,961727 g/mol |
| SMILES | COC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChIKey | YTAXYXOJOYIQQO-UHFFFAOYSA-N |
| PubChem CID | 92213 |
| EC No. | 622-566-3 |
| DTXSID | DTXSID10863461 |
Chemische & physikalische Eigenschaften
| XLogP | 4,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 35,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 16 |
| Formalladung | 0 |
| Komplexität | 249 |
| Siedepunkt | 337.3±37.0 °C(Predicted) |
| Dichte | 1.399±0.06 g/cm3(Predicted) |
| Flammpunkt | -26 °C |
| Lagerbedingungen | 2-8°C |
| BRN | 2135850 |
| InChI | 1S/C10H9Cl3O3/c1-5(10(14)15-2)16-9-4-7(12)6(11)3-8(9)13/h3-5H,1-2H3 |
| InChIKey | YTAXYXOJOYIQQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | 2588 |
| R-Sätze (R) | 22-36-67-65-50/53-38-62-51/53-48/20-11 |
| Gefahrensymbole | Xn,N,F |
| Sicherheitshinweise (S) | 26-36/37-62-61-60-33-29-16-9 |
| Gefahrenklasse | 6.1(b)Acute Tox. 4 OralAquatic Chronic 4Eye Irrit. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 13 - Non Combustible Solids |
Anwendungen & Verwendung
Verwenden
2,4,5-TP methyl ester