HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,2-Epoxycyclopentan
6-OXABICYCLO[3.1.0]HEXANE · 1,2-EPOXYCYCLOPENTANE · Cyclopentene epoxide · 1,2-Epoxycyclopentane, Cyclopentene oxide · cyclopentaneoxide · Epoxycyclopentane · Cyclopentane oxide · CYCLOPENTENE OXIDE
Identifikatoren & physikalische Daten
| CAS No. | 285-67-6 |
|---|---|
| Summenformel | C5H8O |
| Durchschnittliche Molmasse | 84,12 g/mol |
| Monoisotopische Masse | 84,05751488 g/mol |
| SMILES | C1CC2OC2C1 |
| InChIKey | GJEZBVHHZQAEDB-UHFFFAOYSA-N |
| PubChem CID | 9244 |
| DTXSID | DTXSID50861845 |
| Lokaler Name | 1,2-Epoxycyclopentan |
Chemische & physikalische Eigenschaften
| XLogP | 0,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 12,5 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 62,3 |
| SpringerMaterials Properties | Chemical shift |
| Schmelzpunkt | 136-137 °C |
| Siedepunkt | 102 °C(lit.) |
| Dichte | 0.964 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.434(lit.) |
| Flammpunkt | 50 °F |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Liquid |
| Farbe | Clear colorless to very faintly yellow |
| Löslichkeit | Immiscible with water. |
| BRN | 102495 |
| InChI | InChI=1S/C5H8O/c1-2-4-5(3-1)6-4/h4-5H,1-3H2 |
| InChIKey | GJEZBVHHZQAEDB-UHFFFAOYSA-N |
| SMILES | C12C(O1)CCC2 |
| LogP (Verteilungskoeffizient) | 0.908 (est) |
| CAS Datenbank | 285-67-6(CAS DataBase Reference) |
| NIST chemische Informationen | cis-1,2-Epoxycyclopentane(285-67-6) |
| EPA chemische Informationen | 6-Oxabicyclo[3.1.0]hexane (285-67-6) |
Sicherheit & Vorschriften
| Regulatorische Informationen | 6-Oxabicyclo3.1.0hexane: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 2 |
| Zollcode | 29109000 |
| RTECS-Nr. | RN8935000 |
| R-Sätze (R) | 11-36/37/38 |
| Gefahrensymbole | F,Xi |
| Sicherheitshinweise (S) | 16-26-36-36/37/39 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
| Gefahrstoffdaten | 285-67-6(Hazardous Substances Data) |
Anwendungen & Verwendung
Verwenden
Cyclopentene oxide is used to prepare beta-amino alcohols by reacting with aromatic amines using bismuth trichloride as a catalyst.