HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Colchicoside
Nsc32992 · Nsc624672 · Aids012001 · Aids-012001 · Colchicine impurity D · COLCHICOSIDE IMPURITY · COLCHICOSIDE USP/EP/BP · Thiocolchicoside Impurity D
Identifikatoren & physikalische Daten
| CAS No. | 477-29-2 |
|---|---|
| Summenformel | C27H33NO11 |
| Durchschnittliche Molmasse | 547,5 g/mol |
| Monoisotopische Masse | 547,20536087 g/mol |
| SMILES | COc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc2c(c1OC)-c1ccc(OC)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChIKey | UXAFRQPVHYZDED-ZZEDUEFDSA-N |
| PubChem CID | 92763 |
| ChEMBL | CHEMBL5565245 |
| ChEBI | CHEBI:81415 |
| EC No. | 207-513-0 |
| DTXSID | DTXSID301010233 |
Chemische & physikalische Eigenschaften
| XLogP | -1,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 173 |
| H-Brücken-Donoren | 5 |
| H-Brücken-Akzeptoren | 11 |
| Frei drehbare Bindungen | 7 |
| Schwere Atome | 39 |
| Formalladung | 0 |
| Komplexität | 1.010 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 194-197°C |
| Siedepunkt | 620.17°C (rough estimate) |
| Dichte | 1.3430 (rough estimate) |
| Brechungsindex | 1.6400 (estimate) |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | DMF: 30 mg/mlDMSO: 30 mg/mlPBS (pH 7.2): 10 mg/ml |
| Aggregatzustand | A crystalline solid |
| pKa (Säurekonstante) | 12.74±0.70(Predicted) |
| Farbe | Light yellow to yellow |
| FDA UNII | DYD0I854K7 |
| GHS-Piktogramm | GHS06 |
| Signalwort | Danger |
| GHS-Gefahrenhinweise | H301 |
| GHS-Sicherheitshinweise | P264-P270-P301+P310-P321-P330-P405-P501 |
| REACH-Registrierungen | Active |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | REACH registered substance: Colchicoside (EC: 207-513-0) |
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| Signalwort | Danger |
| GHS-Piktogramm | GHS06 |
| GHS-Gefahrenhinweise | H301 |
| REACH-Registrierungen | Active |
| GHS-Sicherheitshinweise | P264-P270-P301+P310-P321-P330-P405-P501 |
Anwendungen & Verwendung
Uses
A significantly toxic Colchicine analog with no anti-inflammatory properties.