Identifikatoren & physikalische Daten
| CAS No. | 372094-13-8 |
|---|
| Summenformel | C16H10ClN3O3 |
|---|
| Durchschnittliche Molmasse | 327,72 g/mol |
|---|
| Monoisotopische Masse | 327,0410689 g/mol |
|---|
| SMILES | O=C(Nc1cccc2ncccc12)c1cc([N+](=O)[O-])ccc1Cl |
|---|
| InChIKey | DWMHVXAMNPTZAD-UHFFFAOYSA-N |
|---|
| PubChem CID | 930280 |
|---|
| ChEMBL | CHEMBL1318905 |
|---|
| DTXSID | DTXSID701319710 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|
| Polarare Oberfläche (TPSA) | 87,8 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 456 |
|---|
| Löslichkeit | 3.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
