HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3,6-Dioxocholan-24-oic acid
3,6-Diketocholanic acid · hyodehydrodeoxycholic acid · 5β-CHOLANIC ACID-3, 6-DIONE · 5-BETA-CHOLANIC ACID-3,6-DIONE · (5β)-3,6-Dioxocholan-24-oic acid · 3,6-dioxo-5-beta-cholan-24-oic acid · Cholan-24-oic acid, 3,6-dioxo-, (5β)-
Identifikatoren & physikalische Daten
| CAS No. | 6868-73-1 |
|---|---|
| Summenformel | C24H36O4 |
| Durchschnittliche Molmasse | 388,5 g/mol |
| Monoisotopische Masse | 388,26135963 g/mol |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChIKey | AWINBLVINXVKTE-FSILYXOFSA-N |
| PubChem CID | 93044 |
| ChEBI | CHEBI:166706 |
| DTXSID | DTXSID50988364 |
Chemische & physikalische Eigenschaften
| XLogP | 4,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 71,4 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 28 |
| Formalladung | 0 |
| Komplexität | 684 |
| Lipide | Lipids -> Sterol Lipids [ST] -> Bile acids and derivatives [ST04] -> C24 bile acids, alcohols, and derivatives [ST0401] |
| Siedepunkt | 544.7±25.0 °C(Predicted) |
| Dichte | 1.120±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 4.76±0.10(Predicted) |