HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
6-Desoxy-D-glucose
D-QUINOVOSE · QUINOVOSE · 6-deoxy-D-glucose crystalline · EPIFUCOSE · Epirhamnose · Isorhodeose · D-ISORHAMNOSE · Glucomethylose
Identifikatoren & physikalische Daten
| CAS No. | 7658-08-4 |
|---|---|
| Summenformel | C6H12O5 |
| Durchschnittliche Molmasse | 164,16 g/mol |
| Monoisotopische Masse | 164,06847348 g/mol |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChIKey | PNNNRSAQSRJVSB-JGWLITMVSA-N |
| PubChem CID | 93579 |
| ChEBI | CHEBI:28140 |
| DTXSID | DTXSID701032788 |
| Lokaler Name | 6-Desoxy-D-glucose |
Chemische & physikalische Eigenschaften
| XLogP | -2,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 98 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 11 |
| Formalladung | 0 |
| Komplexität | 126 |
| Schmelzpunkt | 146° |
| Siedepunkt | 211.61°C (rough estimate) |
| Dichte | 1.1738 (rough estimate) |
| Brechungsindex | 1.4230 (estimate) |
| Lagerbedingungen | −20°C |
| Löslichkeit | H2O: 10 mg/mL, clear, colorless |
| pKa (Säurekonstante) | 12.50±0.20(Predicted) |
| Merck | 13,8169 |
Sicherheit & Vorschriften
| F | 3-10 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29400090 |
| Sicherheitshinweise (S) | 24/25 |
Anwendungen & Verwendung
Verwenden
6-Deoxy-D-Glucose, can be used for the study the role of the carbon 6 hydroxyl group in the biological function of glucose.