HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,4-Bis(4-methyl-α-styryl)benzol
BIS(MSB) · Bis(MSB), 99.5% · 2-Menthylstyrene · P-BIS(O-METHYLSTYRYL)BENZENE · 4-bis(2-methylstyryl)benzene · Bis(MSB), scintillation grade · 1,4-DI(2-METHYLSTYRYL)BENZENE · 1,4-Bis(2-methylstyryl)benzene
Identifikatoren & physikalische Daten
| CAS No. | 13280-61-0 |
|---|---|
| Summenformel | C24H22 |
| Durchschnittliche Molmasse | 310,4 g/mol |
| Monoisotopische Masse | 310,1721507 g/mol |
| SMILES | Cc1ccccc1C=Cc1ccc(C=Cc2ccccc2C)cc1 |
| InChIKey | QKLPIYTUUFFRLV-UHFFFAOYSA-N |
| PubChem CID | 94347 |
| EC No. | 236-285-5 |
| DTXSID | DTXSID6065395 |
| Lokaler Name | 1,4-Bis(4-methyl-α-styryl)benzol |
Chemische & physikalische Eigenschaften
| XLogP | 7,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 370 |
| Stoffklassen | Other Classes -> Aromatic Hydrocarbons |
| SpringerMaterials Properties | Angular frequency |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 180 °C180-182 °C(lit.) |
| Physical Description | Light yellow crystalline solid[Sigma-Aldrich MSDS] |
| Siedepunkt | 385.59°C (rough estimate) |
| Dichte | 1.0591 (estimate) |
| Brechungsindex | 1.9130 (estimate) |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | dioxane: 0.5 g/10 mL at hot, clear to hazy, colorless to light yellow |
| Aggregatzustand | Crystalline Powder |
| Farbe | Light green to yellow-green |
| BRN | 2375845 |
| Stabilität | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C24H22/c1-19-7-3-5-9-23(19)17-15-21-11-13-22(14-12-21)16-18-24-10-6-4-8-20(24)2/h3-18H,1-2H3 |
| InChIKey | QKLPIYTUUFFRLV-UHFFFAOYSA-N |
| SMILES | C1(C=CC2=CC=CC=C2C)=CC=C(C=CC2=CC=CC=C2C)C=C1 |
| CAS Datenbank | 13280-61-0(CAS DataBase Reference) |
| EPA chemische Informationen | Benzene, 1,4-bis[2-(2-methylphenyl)ethenyl]- (13280-61-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | This chemical does not meet GHS hazard criteria for 2.1% (1 of 47) of reports.WarningH302 (95.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P304+P340, P305+P351+P338, P319, P330, P337+P317, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Benzene, 1,4-bis[2-(2-methylphenyl)ethenyl]-: Does not have an individual approval but may be used under an appropriate group standard |
| Gefahrenübersicht | An irritantHarmful by ingestion[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Acute Tox. 4 (95.7%) |
| Protective Action Criteria (PAC) | 7.6 [mg/m3]83 [mg/m3]500 [mg/m3] |
| F | 10-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 2902900000 |
| R-Sätze (R) | 22-36 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 24/25-36-26 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Acute Tox. 4 OralAquatic Chronic 4Eye Irrit. 2 |
Anwendungen & Verwendung
Verwenden
Absolute fluorescence emission in cyclohexane (max): 420nm. Utilized as a scintillator reagent.