HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-((4-(tert-Butyl)phenoxy)methyl)furan-2-carbohydrazide
5-[(4-tert-butylphenoxy)methyl]-2-furohydrazide · 5-[[4-(1,1-Dimethylethyl)phenoxy]methyl]-2-furancarboxylic acid hydrazide · 2-Furancarboxylic acid, 5-[[4-(1,1-dimethylethyl)phenoxy]methyl]-, hydrazide
Identifikatoren & physikalische Daten
| CAS No. | 406471-02-1 |
|---|---|
| Summenformel | C16H20N2O3 |
| Durchschnittliche Molmasse | 288,34 g/mol |
| Monoisotopische Masse | 288,1473925 g/mol |
| SMILES | CC(C)(C)c1ccc(OCc2ccc(C(=O)NN)o2)cc1 |
| InChIKey | HMQCCNVWLFAOLM-UHFFFAOYSA-N |
| PubChem CID | 948639 |
| ChEMBL | CHEMBL1359742 |
| DTXSID | DTXSID301320862 |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 77,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 346 |
| Löslichkeit | 6.2 [ug/mL] (The mean of the results at pH 7.4) |
| Dichte | 1.148±0.06 g/cm3(Predicted) |
| pKa (Säurekonstante) | 12.05±0.10(Predicted) |