HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Isopentyl-4-nitrobenzoat
isopentyl 4-nitrobenzoate · 3-Methylbutyl 4-nitrobenzoate · 4-Nitrobenzoic acid isopentyl ester · 1-Butanol, 3-methyl-, 1-(4-nitrobenzoate)
Identifikatoren & physikalische Daten
| CAS No. | 38120-06-8 |
|---|---|
| Summenformel | C12H15NO4 |
| Durchschnittliche Molmasse | 237,25 g/mol |
| Monoisotopische Masse | 237,10010796 g/mol |
| SMILES | CC(C)CCOC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChIKey | KMOODDWVCAWHMC-UHFFFAOYSA-N |
| PubChem CID | 94875 |
| EC No. | 253-788-5 |
| DTXSID | DTXSID70191530 |
| Lokaler Name | Isopentyl-4-nitrobenzoat |
Chemische & physikalische Eigenschaften
| XLogP | 3,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 72,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 264 |
| Siedepunkt | 348.8±25.0 °C(Predicted) |
| Dichte | 1.154±0.06 g/cm3(Predicted) |
Anwendungen & Verwendung
Verwenden
3-Methylbutyl 4-Nitrobenzoate, has shown to be one of the aromatic nitro compounds possessing larvicidal activity. It can also be used as an intermediate in the synthesis of 3-Fluoro-3-methylButan-1-ol (F593630).