Identifikatoren & physikalische Daten
| CAS No. | 370847-09-9 |
|---|
| Summenformel | C19H19N5O2 |
|---|
| Durchschnittliche Molmasse | 349,4 g/mol |
|---|
| Monoisotopische Masse | 349,15387487 g/mol |
|---|
| SMILES | CN1CCN(c2nc(-c3cccc([N+](=O)[O-])c3)nc3ccccc23)CC1 |
|---|
| InChIKey | IEIJJYXPXGFJHX-UHFFFAOYSA-N |
|---|
| PubChem CID | 949366 |
|---|
| ChEMBL | CHEMBL1441463 |
|---|
| DTXSID | DTXSID401325134 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|
| Polarare Oberfläche (TPSA) | 78,1 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 6 |
|---|
| Frei drehbare Bindungen | 2 |
|---|
| Schwere Atome | 26 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 491 |
|---|
| Löslichkeit | 8.5 [ug/mL] (The mean of the results at pH 7.4) |
|---|
