HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,2-Dibrom-4,5-difluorbenzol
1,2-Dibromo-4,5-difl · 1,2-DIBROMO-4,5-DIFLUOROBENZENE · 1,2-DibroMo-4,5-2-fluorobenzene · 4,5-difluoroortho dibromobenzene · 1,2-Dibromo-4,5-difluorobenzene>Benzene, 1,2-dibromo-4,5-difluoro- · 1,2-Dibromo-4,5-difluorobenzene98% · 1,2-Dibromo-4,5-difluorobenzene,99% · 1,2-Dibromo-4,5-difluorobenzene 98%
Identifikatoren & physikalische Daten
| CAS No. | 64695-78-9 |
|---|---|
| Summenformel | C6H2Br2F2 |
| Durchschnittliche Molmasse | 271,88 g/mol |
| Monoisotopische Masse | 269,8491307 g/mol |
| SMILES | Fc1cc(Br)c(Br)cc1F |
| InChIKey | JTEZQWOKRHOKDG-UHFFFAOYSA-N |
| PubChem CID | 94949 |
| EC No. | 265-021-1 |
| DTXSID | DTXSID50215026 |
| Lokaler Name | 1,2-Dibrom-4,5-difluorbenzol |
Chemische & physikalische Eigenschaften
| XLogP | 3,5 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 106 |
| Stoffklassen | Other Classes -> Halogenated Monoaromatics |
| Physical Description | White crystalline solidmp = 33-35 deg C[Alfa Aesar MSDS] |
| Schmelzpunkt | 33-35 °C (lit.) |
| Siedepunkt | 216.2±35.0 °C(Predicted) |
| Dichte | 2.1030 (rough estimate) |
| Brechungsindex | 1.5151 (estimate) |
| Flammpunkt | 112 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Aggregatzustand | powder to lump to clear liquid |
| Farbe | White or Colorless to Light yellow |
| Löslichkeit | insoluble |
| BRN | 1941132 |
| InChI | InChI=1S/C6H2Br2F2/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
| InChIKey | JTEZQWOKRHOKDG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(F)C=C1Br |
| CAS Datenbank | 64695-78-9(CAS DataBase Reference) |
| NIST chemische Informationen | 1,2-Dibromo-4,5-difluorobenzene(64695-78-9) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (83.7%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | A skin and strong eye irritant[Alfa Aesar MSDS] See 1,2,3,5-Tetrachlorobenzene and 1,2,3,4-Tetrachlorobenzene. |
| Hazard Classes and Categories | Flam. Liq. 3 (83.7%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1325 4.1/PG 2 |
| Zollcode | 29039990 |
| R-Sätze (R) | 10-36/37/38 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 16-26-36/37/39-24/25 |
| Gefahrenklasse | 4.1Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 4.1B - Flammable solid hazardous materials |
Anwendungen & Verwendung
Verwenden
1,2-Dibromo-4,5-difluorobenzene has been used in the preparation of:2,2′-dibromo-4,4′,5,5′-tetrafluorobiphenyl2-(2,3-dibromo-5,6-difluorophenyl)propan-2-ol