Identifikatoren & physikalische Daten
| CAS No. | 748812-30-8 |
|---|
| Summenformel | C18H13NO4 |
|---|
| Durchschnittliche Molmasse | 307,3 g/mol |
|---|
| Monoisotopische Masse | 307,0844579 g/mol |
|---|
| SMILES | O=C(/C=C/c1ccccc1)OCN1C(=O)c2ccccc2C1=O |
|---|
| InChIKey | NIJJDJGSTXBRTN-ZHACJKMWSA-N |
|---|
| PubChem CID | 950280 |
|---|
| ChEMBL | CHEMBL183456 |
|---|
| DTXSID | DTXSID301331809 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,2 |
|---|
| Polarare Oberfläche (TPSA) | 63,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 5 |
|---|
| Schwere Atome | 23 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 483 |
|---|
| Löslichkeit | 2.6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
