Identifikatoren & physikalische Daten
| CAS No. | 672887-35-3 |
|---|
| Summenformel | C12H8F4N2O |
|---|
| Durchschnittliche Molmasse | 272,2 g/mol |
|---|
| Monoisotopische Masse | 272,05727553 g/mol |
|---|
| SMILES | CNc1ccc(Oc2c(F)c(F)nc(F)c2F)cc1 |
|---|
| InChIKey | QNTVJUDODDAUOK-UHFFFAOYSA-N |
|---|
| PubChem CID | 950438 |
|---|
| ChEMBL | CHEMBL1704493 |
|---|
| DTXSID | DTXSID201326750 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|
| Polarare Oberfläche (TPSA) | 34,2 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 275 |
|---|
| Löslichkeit | 6 [ug/mL] (The mean of the results at pH 7.4) |
|---|
