HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 950586Erstellt: 4. November 2026
Ethyl 3-(2-chlorophenyl)-4-methyl-2-sulfanylidene-1,3-thiazole-5-carboxylate
https://huagongshe.com/de/chemical/950586
Identifikatoren & physikalische Daten
| CAS No. | 313514-00-0 |
|---|
| Summenformel | C13H12ClNO2S2 |
|---|
| Durchschnittliche Molmasse | 313,8 g/mol |
|---|
| Monoisotopische Masse | 312,9997987 g/mol |
|---|
| SMILES | CCOC(=O)c1sc(=S)n(-c2ccccc2Cl)c1C |
|---|
| InChIKey | RTFTYIBDLHLYTH-UHFFFAOYSA-N |
|---|
| PubChem CID | 950586 |
|---|
| ChEMBL | CHEMBL1566589 |
|---|
| DTXSID | DTXSID901333758 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 4 |
|---|
| Polarare Oberfläche (TPSA) | 86,9 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 4 |
|---|
| Frei drehbare Bindungen | 4 |
|---|
| Schwere Atome | 19 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 425 |
|---|
| Löslichkeit | 2.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
