HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Chlor-4-fluorbenzol
4-CHLOROFLUOROBENZENE · 4-FLUOROCHLOROBENZENE · 1-Chloro-4-flu · 4-Chlorofluorobenzen · P-FLUOROCHLOROBENZENE · P-CHLOROFLUOROBENZENE · Fluorine chlorobenzene · 4-Fluorophenyl chloride
Identifikatoren & physikalische Daten
| CAS No. | 352-33-0 |
|---|---|
| Summenformel | C6H4ClF |
| Durchschnittliche Molmasse | 130,55 g/mol |
| Monoisotopische Masse | 129,99855603 g/mol |
| SMILES | Fc1ccc(Cl)cc1 |
| InChIKey | RJCGZNCCVKIBHO-UHFFFAOYSA-N |
| PubChem CID | 9604 |
| EC No. | 206-521-1 |
| DTXSID | DTXSID2059853 |
| Lokaler Name | 1-Chlor-4-fluorbenzol |
Chemische & physikalische Eigenschaften
| XLogP | 2,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 66,9 |
| Stoffklassen | Other Classes -> Halogenated Monoaromatics |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Dampfdruck | 8.19 [mmHg] |
| Physical Description | Colorless liquid[Alfa Aesar MSDS] |
| Schmelzpunkt | -21.5 °C |
| Siedepunkt | 129-130 °C(lit.) |
| Dichte | 1.226 g/mL at 25 °C(lit.) |
| Brechungsindex | n20/D 1.495(lit.) |
| Flammpunkt | 85 °F |
| Lagerbedingungen | Flammables area |
| Löslichkeit | Difficult to mix. |
| Aggregatzustand | Liquid |
| Wichte | 1.226 |
| Farbe | Clear colorless to slightly yellow |
| BRN | 1904542 |
| InChI | InChI=1S/C6H4ClF/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChIKey | RJCGZNCCVKIBHO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1 |
| CAS Datenbank | 352-33-0(CAS DataBase Reference) |
| NIST chemische Informationen | Benzene, 1-chloro-4-fluoro-(352-33-0) |
| EPA chemische Informationen | Benzene, 1-chloro-4-fluoro- (352-33-0) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (94.1%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P317, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | A skin and strong eye irritantHarmful by inhalation[Alfa Aesar MSDS] See p-Bromofluorobenzene. |
| Hazard Classes and Categories | Flam. Liq. 3 (94.1%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1993 3/PG 3 |
| Zollcode | 29039990 |
| R-Sätze (R) | 10-36/37/38-39/23/24/25-23/24/25-11 |
| Gefahrensymbole | Xi,F,T |
| hazard_note | Flammable/Irritant |
| Sicherheitshinweise (S) | 16-26-36-37/39-45-36/37-7 |
| Gefahrenklasse | 3Eye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
1-Chloro-4-fluorobenzeneis used as a primary and secondary intermediates, organic synthesis. And it is also used to prepare (4'-fluoro-biphenyl-4-yl)-methyl ether by using reagents NaH, Ni (OAc)2, 2,2 '-bipyridyl, KI and solvents benzene, tetrahydrofuran at temperature of 63°C.