HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1,1'-Methylenbis[4-fluorbenzol]
DFDPM · BIS(4-FLUOROPHENYL)METHANE · 4,4'-Difluorobenzylbenzene · 4,4'-Difluorodiphenylamine · BIS(P-FLUOROPHENYL)METHANE · 4,4'-Difluorodiphenylmethane · 4，4'-Difluorodiphenylmethane · Bis(4-fluorophenyl)methane,99%
![Molekülstruktur von 1,1'-Methylenbis[4-fluorbenzol]](/img/chemical/96094.png)
Identifikatoren & physikalische Daten
| CAS No. | 457-68-1 |
|---|---|
| Summenformel | C13H10F2 |
| Durchschnittliche Molmasse | 204,21 g/mol |
| Monoisotopische Masse | 204,07505676 g/mol |
| SMILES | Fc1ccc(Cc2ccc(F)cc2)cc1 |
| InChIKey | DXQVFHQUHOFROC-UHFFFAOYSA-N |
| PubChem CID | 96094 |
| EC No. | 207-274-2 |
| DTXSID | DTXSID10196600 |
| Lokaler Name | 1,1'-Methylenbis[4-fluorbenzol] |
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 157 |
| Schmelzpunkt | 29-30 °C(lit.) |
| Siedepunkt | 258-260 °C742 mm Hg(lit.) |
| Dichte | 1.145 g/mL at 25 °C(lit.) |
| Dampfdruck | 0.933Pa at 50℃ |
| Brechungsindex | n20/D 1.536(lit.) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | 2-30°C |
| Aggregatzustand | Crystalline |
| Farbe | White or Colorless to Light yellow |
| Wichte | 1.145 |
| Löslichkeit | Insoluble in water. |
| BRN | 1956387 |
| InChI | InChI=1S/C13H10F2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h1-8H,9H2 |
| InChIKey | DXQVFHQUHOFROC-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1 |
| CAS Datenbank | 457-68-1(CAS DataBase Reference) |
| NIST chemische Informationen | Bis(4-fluorophenyl)methane(457-68-1) |
Sicherheit & Vorschriften
| Regulatorische Informationen | Status: Cease Manufacture Update: 03-11-2010 https://echa.europa.eu/registration-dossier/-/registered-dossier/11975 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29036990 |
| R-Sätze (R) | 21/22 |
| Gefahrensymbole | Xn,Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 28A-24/25 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff.