HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Perfluor(methylcyclohexan)
1-(Trifluoromethyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane · FLUTEC PP2 · FLUTECR PP2 · Perfluor-(methylcyclohexan) · Perfluoro(methylcyclohexane) · PERFLUOROMETHYLCYCLOHEXANE 97+% · Perfluoro(methylcyclohexane)95% · TETRADECAFLUOROMETHYLCYCLOHEXANE
Identifikatoren & physikalische Daten
| CAS No. | 355-02-2 |
|---|---|
| Summenformel | C7F14 |
| Durchschnittliche Molmasse | 350,05 g/mol |
| Monoisotopische Masse | 349,97764508 g/mol |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChIKey | QIROQPWSJUXOJC-UHFFFAOYSA-N |
| PubChem CID | 9637 |
| EC No. | 206-573-5 |
| DTXSID | DTXSID5059874 |
| Lokaler Name | Perfluor(methylcyclohexan) |
Chemische & physikalische Eigenschaften
| XLogP | 4,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 14 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 21 |
| Formalladung | 0 |
| Komplexität | 411 |
| Stoffklassen | Other Classes -> Halogenated Cyclic Hydrocarbons |
| PFAS | PFAS -> Other/unspecifiedPFAS -> non-polymerPFAS -> OECD CategoryPFAS -> Cyclic PFASPFAS -> PFAS identified in REACH Regulation EC No. 1272/2008 |
| SpringerMaterials Properties | Boiling point |
| Physical Description | Colorless liquid[Alfa Aesar MSDS] |
| Schmelzpunkt | -37 °C |
| Siedepunkt | 76 °C(lit.) |
| Dichte | 1.80 g/mL at 20 °C |
| Dampfdruck | 14kPa at 25℃ |
| Brechungsindex | n17/D 1.285(lit.) |
| Flammpunkt | 75-76°C |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | Miscible with acetone and benzene. |
| Aggregatzustand | Oil |
| Farbe | Colourless |
| Wichte | 1.787 |
| Spezifische Wärmekapazität | Cp(liquid): 1.01 J/(g·K), at 25℃ |
| BRN | 1915981 |
| Dielektrizitätskonstante | 1.8600000000000001 |
| Kosmetik-Inhaltsstoffe Funktionen | BINDINGABSORBENTEMULSION STABILISINGSKIN CONDITIONINGANTICAKING |
| InChI | 1S/C7F14/c8-1(7(19,20)21)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12 |
| InChIKey | QIROQPWSJUXOJC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| LogP (Verteilungskoeffizient) | 666 at 25℃ |
| CAS Datenbank | 355-02-2(CAS DataBase Reference) |
| EPA chemische Informationen | Cyclohexane, 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-6-(trifluoromethyl)- (355-02-2) |
Sicherheit & Vorschriften
| GHS-Einstufung | This chemical does not meet GHS hazard criteria for 100% (23 of 23) of all reports.Not ClassifiedAggregated GHS information provided per 23 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 05-07-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/24227 |
| Gefahrenübersicht | An irritant[Alfa Aesar MSDS] See Dodecafluorocyclohexane. |
| Hazard Classes and Categories | Not Classified |
| Toxicity Data | LCLo (rat) = 825 ppm/14hr |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29038900 |
| RTECS-Nr. | GV7610000 |
| R-Sätze (R) | 36/37/38 |
| Toxizität | LCLo ihl-rat: 825 ppm/14H 11FYAN 3,90,63 |
| Gefahrensymbole | Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 24/25 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
Perfluoro(methylcyclohexane) is used as a solvent to determine fluorophilicity of hydrocarbon and fluorocarbon-functionalized nicotinic acid esters. It combines with chloroform and acts as an ingredient for "fluorous" biphase reactions. Furthermore, it finds application as a heat transfer agent, a dielectric fluid and a perfluorocarbon tracer. It acts as a good solvent for gases.