HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 9672002Erstellt: 4. November 2026
4-((E)-((1,3-Benzodioxol-5-ylcarbonyl)hydrazono)methyl)-2-ethoxyphenyl 2,4-dichlorobenzoate
https://huagongshe.com/de/chemical/9672002
Identifikatoren & physikalische Daten
| CAS No. | 477731-90-1 |
|---|
| Summenformel | C24H18Cl2N2O6 |
|---|
| Durchschnittliche Molmasse | 501,3 g/mol |
|---|
| Monoisotopische Masse | 500,0541917 g/mol |
|---|
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccc3c(c2)OCO3)ccc1OC(=O)c1ccc(Cl)cc1Cl |
|---|
| InChIKey | CDZFUICNEZPSMT-KKMKTNMSSA-N |
|---|
| PubChem CID | 9672002 |
|---|
| EC No. | 647-721-2 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 5,6 |
|---|
| Polarare Oberfläche (TPSA) | 95,5 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 7 |
|---|
| Frei drehbare Bindungen | 8 |
|---|
| Schwere Atome | 34 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 740 |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
