HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Fluoracetophenon
2-FLUOROACETOPHENONE · 1-(2-FLUOROPHENYL)ETHANONE · 2'-Fluoro · Vonoprazan-041 · uoroacetophenone · 2-Fluoracetophenon · TAK438 Impurity 97 · Fluoroacetophenone1
Identifikatoren & physikalische Daten
| CAS No. | 445-27-2 |
|---|---|
| Summenformel | C8H7FO |
| Durchschnittliche Molmasse | 138,14 g/mol |
| Monoisotopische Masse | 138,04809306 g/mol |
| SMILES | CC(=O)c1ccccc1F |
| InChIKey | QMATYTFXDIWACW-UHFFFAOYSA-N |
| PubChem CID | 96744 |
| DTXSID | DTXSID50196200 |
| Lokaler Name | 2-Fluoracetophenon |
Chemische & physikalische Eigenschaften
| XLogP | 1,6 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 133 |
| Schmelzpunkt | 26-27C |
| Siedepunkt | 187-189 °C(lit.) |
| Dichte | 1.137 g/mL at 20 °C(lit.) |
| Brechungsindex | n20/D 1.507(lit.) |
| Flammpunkt | 143 °F |
| Lagerbedingungen | Sealed in dry,Room Temperature |
| Löslichkeit | Soluble in Acetone, Chloroform, Dichloromethane, Ethanol, Ethyl Acetate and Methanol. |
| Aggregatzustand | Liquid |
| Wichte | 1.121 |
| Farbe | Clear colorless to yellow |
| BRN | 2041344 |
| InChI | InChI=1S/C8H7FO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| InChIKey | QMATYTFXDIWACW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1F)C |
| CAS Datenbank | 445-27-2(CAS DataBase Reference) |
| NIST chemische Informationen | o-Fluoroacetophenone(445-27-2) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | 1993 |
| Zollcode | 29147090 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36-37/39-37 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2'-Fluoroacetophenone is used as starting reagent in the synthesis of ascididemin. It is used to produce 1-(2-piperidin-1-yl-phenyl)-ethanone by reaction with piperidine.