HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Iodpyridin-3-ol
2-IODOPYRIDIN-3-OL · 2-iodpyridin-3-ol · 2-Iodopyridine-3-ol · 3-Pyridinol, 2-iodo- · 3-HYDROXY-2-IODOPYRIDINE · 2-IODO-3-HYDROXYPYRIDINE · 2-HYDROXY-3-IODOPYRIDINE · 2-lodo-3-hydroxypyridine
Identifikatoren & physikalische Daten
| CAS No. | 40263-57-8 |
|---|---|
| Summenformel | C5H4INO |
| Durchschnittliche Molmasse | 221 g/mol |
| Monoisotopische Masse | 220,93376175 g/mol |
| SMILES | Oc1cccnc1I |
| InChIKey | HJBGMPCMSWJZNH-UHFFFAOYSA-N |
| PubChem CID | 97179 |
| EC No. | 254-864-0 |
| DTXSID | DTXSID50193254 |
| Lokaler Name | 2-Iodpyridin-3-ol |
Chemische & physikalische Eigenschaften
| XLogP | 1,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 33,1 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 78,8 |
| Schmelzpunkt | 193-195°C |
| Siedepunkt | 296.6±20.0 °C(Predicted) |
| Dichte | 2.142±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| pKa (Säurekonstante) | 4.74±0.10(Predicted) |
| Aggregatzustand | Crystalline Powder |
| Farbe | White to tan |
| Löslichkeit | Slightly soluble in water. |
| BRN | 109836 |
| InChI | InChI=1S/C5H4INO/c6-5-4(8)2-1-3-7-5/h1-3,8H |
| InChIKey | HJBGMPCMSWJZNH-UHFFFAOYSA-N |
| SMILES | C1(I)=NC=CC=C1O |
| CAS Datenbank | 40263-57-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (87%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (87%) |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 2933399990 |
| R-Sätze (R) | 36/37/38-41-37/38-22 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-36-39 |
| Gefahrenklasse | IRRITANTAcute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
2-Iodo-3-hydroxypyridine acts as a reagent in the synthesis of the differentiating antibiotic azatyrosine