HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Stannane, dibromodicyclohexyl-
Dicyclohexyltin dibromide · dibromo(dicyclohexyl)stannane · Stannane, dibromodicyclohexyl-
Identifikatoren & physikalische Daten
| CAS No. | 2954-94-1 |
|---|---|
| Summenformel | C12H22Br2Sn |
| Durchschnittliche Molmasse | 444,82 g/mol |
| Monoisotopische Masse | 443,91103 g/mol |
| SMILES | [Br][Sn]([Br])([CH]1CCCCC1)[CH]1CCCCC1 |
| InChIKey | RHFTTZVNBAHQBF-UHFFFAOYSA-L |
| PubChem CID | 97477 |
| EC No. | 677-892-9 |
| DTXSID | DTXSID40183725 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 15 |
| Formalladung | 0 |
| Komplexität | 174 |
| Schmelzpunkt | 58°C |
| Siedepunkt | 150°C/0.3mm |
| Flammpunkt | 150°C/0.3mm |
| Aggregatzustand | Crystalline |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| UN-Transportnummer | UN3146 |
| Gefahrenklasse | 6.1 |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
Dicyclohexyltin dibromide is an important chemical compound used in Pharmacology for inhibition of pancreatic cancer cell lines by organotin polyesters.