HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Brompropionylchlorid
2-Bromopropanoyl chloride · 2-Bromopropionic acid chloride · A-BROMOPROPIONYL CHLORIDE · 2-BROMOPROPIONYL CHLORIDE · 2-BROMINEPROPIONYLCHLORIDE · 2-BromopropionylChloride>Propanoyl chloride, 2-bromo- · ALPHA-BROMOPROPIONYL CHLORIDE · 2-Bromopropionyl chloride,98%
Identifikatoren & physikalische Daten
| CAS No. | 7148-74-5 |
|---|---|
| Summenformel | C3H4BrClO |
| Durchschnittliche Molmasse | 171,42 g/mol |
| Monoisotopische Masse | 169,91340453 g/mol |
| SMILES | CC(Br)C(=O)Cl |
| InChIKey | OZGMODDEIHYPRY-UHFFFAOYSA-N |
| PubChem CID | 97980 |
| EC No. | 230-466-2 |
| DTXSID | DTXSID70871183 |
| Lokaler Name | 2-Brompropionylchlorid |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 17,1 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 6 |
| Formalladung | 0 |
| Komplexität | 63,8 |
| Siedepunkt | 131-133 °C (lit.) |
| Dichte | 1.7 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.477(lit.) |
| Flammpunkt | 125 °F |
| Lagerbedingungen | Store at RT. |
| Aggregatzustand | Liquid |
| Farbe | Clear yellow |
| Löslichkeit | REACTS |
| BRN | 773800 |
| InChI | InChI=1S/C3H4BrClO/c1-2(4)3(5)6/h2H,1H3 |
| InChIKey | OZGMODDEIHYPRY-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C(Br)C |
| CAS Datenbank | 7148-74-5(CAS DataBase Reference) |
| NIST chemische Informationen | 2-Bromopropionyl chloride(7148-74-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P271, P280, P301+P330+P331, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P319, P321, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | Status: Active Update: 10-07-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/23669 |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| F | 9-21 |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 2920 8/PG 2 |
| Zollcode | 29159000 |
| R-Sätze (R) | 10-34-36/37 |
| Gefahrensymbole | C |
| Sicherheitshinweise (S) | 16-26-27-36/37/39-45-25 |
| Gefahrenklasse | 8Eye Dam. 1Flam. Liq. 3Skin Corr. 1BSTOT SE 3 |
| Verpackungsgruppe | II |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
2-Bromopropionyl chloride was used to synthesize cellulose macroinitiator for homogeneous atom transfer radical polymerization. It was used in the synthesis of 2-aminopropionyl polystyrene resin by Friedel Crafts reaction.