HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Ergocristin
NSC 93743 · ergocrystine · ERGOCRISTINE · Ergocristine-RM · Ergocristine in dried down · Dihydro Ergotamine Impurity 6 · 12'-Hydroxy-2'-isopropyl-5'α-benzylergotaman-3',6',18-trione · 6’,18-trione,12’-hydroxy-2’-(1-methylethyl)-5’-(phenylmethyl)-ergotaman-3
Identifikatoren & physikalische Daten
| CAS No. | 511-08-0 |
|---|---|
| Summenformel | C35H39N5O5 |
| Durchschnittliche Molmasse | 609,7 g/mol |
| Monoisotopische Masse | 609,29511936 g/mol |
| SMILES | CC(C)C1(NC(=O)C2C=C3c4cccc5[nH]cc(c45)CC3N(C)C2)OC2(O)C3CCCN3C(=O)C(Cc3ccccc3)N2C1=O |
| InChIKey | HEFIYUQVAZFDEE-UHFFFAOYSA-N |
| PubChem CID | 98255 |
| Lokaler Name | Ergocristin |
Chemische & physikalische Eigenschaften
| XLogP | 3 |
|---|---|
| Polarare Oberfläche (TPSA) | 118 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 45 |
| Formalladung | 0 |
| Komplexität | 1.270 |
| Schmelzpunkt | 155-157 °C(lit.) |
| Siedepunkt | 655.69°C (rough estimate) |
| Dichte | 1.1839 (rough estimate) |
| Brechungsindex | 1.7500 (estimate) |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | powder |
| pKa (Säurekonstante) | 9.59±0.60(Predicted) |
| Farbe | Off-white |
| Stabilität | Hygroscopic |
Sicherheit & Vorschriften
| UN-Transportnummer | 1544 |
|---|---|
| Zollcode | 29396900 |
| RTECS-Nr. | KE1180000 |
| R-Sätze (R) | 23/24/25 |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 22-36/37/39-45-24/25 |
| Gefahrenklasse | 6.1(b) |
| Verpackungsgruppe | III |
| Gefahrstoffdaten | 511-08-0(Hazardous Substances Data) |
Anwendungen & Verwendung
Verwenden
A derivative of lysergic acid and a natural ergot alkaloid which is a member of the ergotoxine group. Its intraocular pressure lowering effect makes it potential candidate for future applications in ocular pharmacology.