HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Methylpyrrolidin-2-ethylamin
2-(1-methylpyrrolidin-2-yl)ethan-1-amine · 2-(2-Aminoethyl)-1-methyl · 2-(2-Aminoethyl)-1-methylpy · N-Methyl-2-(2-aMinoethyl)pyr · 1-Methyl-2-Pyrrolidineethanamine · 1-methylpyrrolidine-2-ethylamine · 2-AMinoethyl-1-Methylpyrrolidine · N-Methyl-2-Pyrrolidineethanamine
Identifikatoren & physikalische Daten
| CAS No. | 51387-90-7 |
|---|---|
| Summenformel | C7H16N2 |
| Durchschnittliche Molmasse | 128,22 g/mol |
| Monoisotopische Masse | 128,13134851 g/mol |
| SMILES | CN1CCCC1CCN |
| InChIKey | PNHGJPJOMCXSKN-UHFFFAOYSA-N |
| PubChem CID | 98388 |
| ChEBI | CHEBI:234484 |
| EC No. | 257-169-0 |
| DTXSID | DTXSID401291397 |
| Lokaler Name | 1-Methylpyrrolidin-2-ethylamin |
Chemische & physikalische Eigenschaften
| XLogP | 0,2 |
|---|---|
| Polarare Oberfläche (TPSA) | 29,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 83 |
| Siedepunkt | 152.7±8.0 °C(Predicted) |
| Dichte | 0.885 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.4684(lit.) |
| Flammpunkt | 149 °F |
| Lagerbedingungen | Keep in dark place,Inert atmosphere,Room temperature |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| pKa (Säurekonstante) | 10.34±0.40(Predicted) |
| Aggregatzustand | Powder |
| Farbe | Light beige to light brown |
| InChI | InChI=1S/C7H16N2/c1-9-6-2-3-7(9)4-5-8/h7H,2-6,8H2,1H3 |
| InChIKey | PNHGJPJOMCXSKN-UHFFFAOYSA-N |
| SMILES | N1(C)CCCC1CCN |
| CAS Datenbank | 51387-90-7(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH302 (97.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.7%) |
| Wassergefährdungsklasse (WGK) | 2 |
| UN-Transportnummer | 2735 |
| Zollcode | 29339900 |
| R-Sätze (R) | 22-37/38-41 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 26-39 |
| Gefahrenklasse | 8Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
2-(2-Aminoethyl)-1-methylpyrrolidine is used as an electrochemiluminescence probe within microfluidic chip for ECL detection. 2-(2-Aminoethyl)-1-methylpyrrolidine is also used in chemical microarrays to identify ligands that bind pathogenic cells.