HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
1-Cyclopropyl-7-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
1-Cyclopropyl-7-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid · 1-Cyclopropyl-7-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid · 3-Quinolinecarboxylic acid, 1-cyclopropyl-7-fluoro-1,4-dihydro-4-oxo-
Identifikatoren & physikalische Daten
| CAS No. | 157372-99-1 |
|---|---|
| Summenformel | C13H10FNO3 |
| Durchschnittliche Molmasse | 247,22 g/mol |
| Monoisotopische Masse | 247,06447134 g/mol |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(F)ccc2c1=O |
| InChIKey | SZESLTPCOVTJOL-UHFFFAOYSA-N |
| PubChem CID | 9859708 |
| DTXSID | DTXSID80431974 |
Chemische & physikalische Eigenschaften
| XLogP | 1,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 57,6 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 430 |
| Siedepunkt | 408.5±45.0 °C(Predicted) |
| Dichte | 1.560±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| pKa (Säurekonstante) | 6.44±0.41(Predicted) |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H317 |
Anwendungen & Verwendung
Verwenden
1-Cyclopropyl-7-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic Acid can be used to prepare iminoquinolinecarboxamides. It can also be used as a reagent to prepare 1-alkyl-1,4-dihydro-4-imino-3-quinolinecarboxylic acid derivatives.