HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
(2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butyronitrile
(αS,βR)-β-(2,4-Difluorophenyl)-β-hydroxy-α-Methyl-1H-1,2,4-triazole-1-butanenitrile · [R-(R*,S*)]-β-(2,4-Difluorophenyl)-β-hydroxy-α-Methyl-1H-1,2,4-triazole-1-butanenitrile · 1H-1,2,4-Triazole-1-butanenitrile, β-(2,4-difluorophenyl)-β-hydroxy-α-methyl-, (αS,βR)- · (2S,3R)-3-(2,4-difluorophenyl)-3-hydroxy-2-Methyl-4-(1H-1,2,4-triazol-1-yl)butanenitrile · (alphaS,betaR)-beta-(2,4-Difluorophenyl)-beta-hydroxy-alpha-methyl-1H-1,2,4-triazole-1-butanenitrile
Identifikatoren & physikalische Daten
| CAS No. | 170862-36-9 |
|---|---|
| Summenformel | C13H12F2N4O |
| Durchschnittliche Molmasse | 278,26 g/mol |
| Monoisotopische Masse | 278,09791744 g/mol |
| SMILES | C[C@@H](C#N)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| InChIKey | ZURMGBIMFHVPNC-TVQRCGJNSA-N |
| PubChem CID | 9860445 |
| DTXSID | DTXSID80432007 |
Chemische & physikalische Eigenschaften
| XLogP | 0,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 74,7 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 20 |
| Formalladung | 0 |
| Komplexität | 388 |
| Schmelzpunkt | 178-182 °C(Solv: isopropanol (67-63-0)) |
| Siedepunkt | 522.5±60.0 °C(Predicted) |
| Dichte | 1.32±0.1 g/cm3(Predicted) |
| Lagerbedingungen | -20°C Freezer |
| Löslichkeit | Chloroform (Slightly), Methanol (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 11.15±0.29(Predicted) |
| Farbe | Light Beige Beige |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
(αS,βR)-β-(2,4-Difluorophenyl)-β-hydroxy-α-Methyl-1H-1,2,4-triazole-1-butanenitrile is used in the preparation of triazole antifungal agents.