HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
HCID 98685Erstellt: 31. Oktober 2026
1-Ethyl-1,3-diphenylharnstoff
1-ethyl-1,3-diphenylurea · Urea, N-ethyl-N,N'-diphenyl-
https://huagongshe.com/de/chemical/98685
Identifikatoren & physikalische Daten
| CAS No. | 64544-71-4 |
|---|
| Summenformel | C15H16N2O |
|---|
| Durchschnittliche Molmasse | 240,3 g/mol |
|---|
| Monoisotopische Masse | 240,12626314 g/mol |
|---|
| SMILES | CCN(C(=O)Nc1ccccc1)c1ccccc1 |
|---|
| InChIKey | NCPIMZDJJZLMCF-UHFFFAOYSA-N |
|---|
| PubChem CID | 98685 |
|---|
| ChEMBL | CHEMBL1393651 |
|---|
| EC No. | 264-940-5 |
|---|
| DTXSID | DTXSID10214818 |
|---|
| Lokaler Name | 1-Ethyl-1,3-diphenylharnstoff |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 2,1 |
|---|
| Polarare Oberfläche (TPSA) | 32,3 |
|---|
| H-Brücken-Donoren | 1 |
|---|
| H-Brücken-Akzeptoren | 1 |
|---|
| Frei drehbare Bindungen | 3 |
|---|
| Schwere Atome | 18 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 255 |
|---|
| LogP (Verteilungskoeffizient) | 3.1 |
|---|
| Schmelzpunkt | 90.5-91 °C(Solv: ethanol (64-17-5)) |
|---|
| Siedepunkt | 423.3±18.0 °C(Predicted) |
|---|
| Dichte | 1.172±0.06 g/cm3(Predicted) |
|---|
| pKa (Säurekonstante) | 14.50±0.70(Predicted) |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P272, P280, P301+P317, P302+P352, P321, P330, P333+P317, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Alarmwort | Warnung |
|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
|---|
