HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
12'-Hydroxy-5'α-isobutyl-2'-isopropylergotaman-3',6',18-trion
ergocryptine · ergokryptine · ALPHA-ERGOCRYPTINE · Bromocriptine EP Impurity B · Ergocrypyine · Ergocriptine · A-ergocryptine · α-Ergocryptine
Identifikatoren & physikalische Daten
| CAS No. | 511-09-1 |
|---|---|
| Summenformel | C32H41N5O5 |
| Durchschnittliche Molmasse | 575,7 g/mol |
| Monoisotopische Masse | 575,31076943 g/mol |
| SMILES | CC(C)CC1C(=O)N2CCCC2C2(O)OC(NC(=O)C3C=C4c5cccc6[nH]cc(c56)CC4N(C)C3)(C(C)C)C(=O)N12 |
| InChIKey | YDOTUXAWKBPQJW-UHFFFAOYSA-N |
| PubChem CID | 99049 |
| Lokaler Name | 12'-Hydroxy-5'α-isobutyl-2'-isopropylergotaman-3',6',18-trion |
Chemische & physikalische Eigenschaften
| XLogP | 2,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 118 |
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 5 |
| Schwere Atome | 42 |
| Formalladung | 0 |
| Komplexität | 1.190 |
| Collision Cross Section | 236.1 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| Schmelzpunkt | 152-154°C |
| Siedepunkt | 636.59°C (rough estimate) |
| Dichte | 1.1762 (rough estimate) |
| Brechungsindex | 1.7500 (estimate) |
| Lagerbedingungen | −20°C |
| Löslichkeit | 45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin: 0.3 mg/mL |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 9.61±0.60(Predicted) |
| Farbe | Pale Yellow to Pale Beige |
| Stabilität | Hygroscopic |
| InChIKey | YDOTUXAWKBPQJW-YBALXUQENA-N |
| SMILES | [C@@]12(O)O[C@@](C(C)C)(NC(=O)[C@H]3CN(C4CC5=CNC6=CC=CC(=C56)C4=C3)C)C(=O)N1[C@@H](CC(C)C)C(=O)N1CCCC21 |&1:0,3,10,30,r| |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | UN 1544 6.1/PG 3 |
| RTECS-Nr. | KE1400000 |
| R-Sätze (R) | 62 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 36/37 |
| Gefahrenklasse | 6.1(b) |
| Verpackungsgruppe | III |
Anwendungen & Verwendung
Verwenden
An impurity of 2-Bromo α-Ergocriptine Mesylate (B682600).