HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide;hydrochloride
SSR504734 · SSR504734 HCl · Compound 1549 · SSR 504734 hydrochloride · 2-Chloro-3-(trifluoromethyl)-N-((S)-phenyl((S)-piperidin-2-yl)methyl)benzamide hydrochloride
![Molekülstruktur von 2-Chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide;hydrochloride](/img/chemical/9954539.png)
Identifikatoren & physikalische Daten
| CAS No. | 615571-23-8 |
|---|---|
| Summenformel | C20H21Cl2F3N2O |
| Durchschnittliche Molmasse | 433,3 g/mol |
| Monoisotopische Masse | 432,0983032 g/mol |
| SMILES | Cl.O=C(N[C@@H](c1ccccc1)[C@@H]1CCCCN1)c1cccc(C(F)(F)F)c1Cl |
| InChIKey | YGCZZYKACZXKHK-AKXYIILFSA-N |
| PubChem CID | 9954539 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 41,1 |
|---|---|
| H-Brücken-Donoren | 3 |
| H-Brücken-Akzeptoren | 5 |
| Frei drehbare Bindungen | 4 |
| Schwere Atome | 28 |
| Formalladung | 0 |
| Komplexität | 496 |
| Lagerbedingungen | 4°C, away from moisture and light |
| Aggregatzustand | Solid |
| Farbe | White to off-white |