HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Fluoranisol
1-Fluoro-3-methoxybenzene · 3-fluroanisole · 3-Fluoroanisole · M-FLUOROANISOLE · 3-Fluoroanisole>3-Fluoroanisole 99% · 3-Fluoroanisole,99% · Inter-fluoro-anisole · 3-Fluoroanisole, 98%+
Identifikatoren & physikalische Daten
| CAS No. | 456-49-5 |
|---|---|
| Summenformel | C7H7FO |
| Durchschnittliche Molmasse | 126,13 g/mol |
| Monoisotopische Masse | 126,04809306 g/mol |
| SMILES | COc1cccc(F)c1 |
| InChIKey | MFJNOXOAIFNSBX-UHFFFAOYSA-N |
| PubChem CID | 9975 |
| EC No. | 207-267-4 |
| DTXSID | DTXSID90196567 |
| Lokaler Name | 3-Fluoranisol |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 9,2 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 85 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP (Verteilungskoeffizient) | 2.43 |
| Schmelzpunkt | -35°C |
| Siedepunkt | 158 °C/743 mmHg (lit.) |
| Dichte | 1.104 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.488(lit.) |
| Flammpunkt | 111 °F |
| Lagerbedingungen | Sealed in dry,2-8°C |
| Löslichkeit | Chloroform, Methanol |
| Aggregatzustand | Oil |
| Farbe | Colourless |
| Wichte | 1.104 |
| BRN | 1858895 |
| InChI | InChI=1S/C7H7FO/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
| InChIKey | MFJNOXOAIFNSBX-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(OC)=C1 |
| CAS Datenbank | 456-49-5(CAS DataBase Reference) |
| NIST chemische Informationen | m-Fluoroanisole(456-49-5) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN 1993 3/PG 3 |
| Zollcode | 29093090 |
| R-Sätze (R) | 10 |
| Gefahrensymbole | F |
| hazard_note | Flammable |
| Sicherheitshinweise (S) | 16 |
| Gefahrenklasse | 3Flam. Liq. 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
3-Fluoroanisole is used in the preparation of tertiary benzylic nitriles.