HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
8-Hydroxycarvedilol
8-Hydroxy Carvedilol · 5-[2-hydroxy-3-[2-(2-methoxyphenoxy)ethylamino]propoxy]-9H-carbazol-1-ol · 9H-Carbazol-1-ol, 5-[2-hydroxy-3-[[2-(2-methoxyphenoxy)ethyl]amino]propoxy]-
Identifikatoren & physikalische Daten
| CAS No. | 159426-95-6 |
|---|---|
| Summenformel | C24H26N2O5 |
| Durchschnittliche Molmasse | 422,5 g/mol |
| Monoisotopische Masse | 422,18417193 g/mol |
| SMILES | COc1ccccc1OCCNCC(O)COc1cccc2[nH]c3c(O)cccc3c12 |
| InChIKey | GPPVNZVFGNMPNR-UHFFFAOYSA-N |
| PubChem CID | 9979639 |
| ChEBI | CHEBI:166542 |
Chemische & physikalische Eigenschaften
| XLogP | 3,8 |
|---|---|
| Polarare Oberfläche (TPSA) | 96 |
| H-Brücken-Donoren | 4 |
| H-Brücken-Akzeptoren | 6 |
| Frei drehbare Bindungen | 10 |
| Schwere Atome | 31 |
| Formalladung | 0 |
| Komplexität | 538 |
| Arzneimittel | Pharmaceuticals -> Metabolite of Carvedilol |
| Schmelzpunkt | >130°C (dec.) |
| Siedepunkt | 702.0±60.0 °C(Predicted) |
| Dichte | 1.305±0.06 g/cm3(Predicted) |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | DMSO (Slightly) |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 9.92±0.30(Predicted) |
| Farbe | Pale Red to Light Red |
Anwendungen & Verwendung
Verwenden
8-Hydroxy Carvedilol is a metabolite of Carvedilol (C184625) found in humans, rats, dogs and mice. 8-Hydroxy Carvedilol is a β androneceptor antagonist with antioxidant and free radical scavenger activity.