JK184
JK 184 · CS-2369 · JK184 (JK-184 · JK184, 10 mM in DMSO · Hh Signaling Antagonist VII · Hh Signaling Antagonist VII, JK184 · JK 184, Hedgehog signaling inhibitor · JK-184
Identifiers & Physical Properties
| CAS No. | 315703-52-7 |
|---|---|
| Molecular formula | C19H18N4OS |
| Average molar mass | 350.4 g/mol |
| Monoisotopic mass | 350.12013238 g/mol |
| SMILES | CCOc1ccc(Nc2nc(-c3c(C)nc4ccccn34)cs2)cc1 |
| InChIKey | ROYXIPOUVGDTAO-UHFFFAOYSA-N |
| PubChem CID | 1069686 |
| ChEMBL | CHEMBL514622 |
| EC No. | 683-690-1 |
| DTXSID | DTXSID70360042 |
Chemical & Physical Properties
| XLogP | 5.1 |
|---|---|
| Topological polar surface area | 79.7 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 5 |
| Rotatable bonds | 5 |
| Heavy atoms | 25 |
| Formal charge | 0 |
| Complexity | 432 |
| Storage conditions | Keep in dark place,Inert atmosphere,2-8°C |
| Solubility | DMSO: ≥20mg/mL |
| Physical state | powder |
| Color | off-white to light brown |
| InChI | 1S/C19H18N4OS/c1-3-24-15-9-7-14(8-10-15)21-19-22-16(12-25-19)18-13(2)20-17-6-4-5-11-23(17)18/h4-12H,3H2,1-2H3,(H,21,22) |
| InChIKey | ROYXIPOUVGDTAO-UHFFFAOYSA-N |
| UNSPSC Code | 12352200 |
| GHS pictogram | GHS05,GHS07 |
| Signal word | Danger |
| GHS hazard statements | H302-H318 |
| GHS precautionary statements | P280-P305+P351+P338 |
| Hazard symbols | Xn |
| Risk statements (R) | 22-41 |
| Safety statements (S) | 26-36 |
| Water hazard class (WGK) | 3 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| GHS classification | DangerH302 (97.4%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.4%) |
| Water hazard class (WGK) | 3 |
| Risk statements (R) | 22-41 |
| Signal word | Danger |
| GHS pictogram | GHS05,GHS07 |
| Hazard symbols | Xn |
| Safety statements (S) | 26-36 |
| Storage class | 11 - Combustible Solids |
| GHS hazard statements | H302-H318 |
| GHS precautionary statements | P280-P305+P351+P338 |
Applications & Uses
Uses
JK 184 is an imidazopyridine derivative that inhibits downstream hedgehog signaling, preventing Gli-dependent transcriptional activity (IC50 = 30 nM). It does so by inhibiting alcohol dehydrogenase 7 (IC50 = 210 nM) and depolymerizing microtubules, preventing their assembly, which is crucial for Gli function. JK 184 exhibits antiproliferative activity in a range of cancer cell lines (L3.6pl, Panc 05.04, BxPC3, D283 med, Daoy; GI50s = 3-21 nM) and in L3.6pl and BxPC3 pancreatic cancer xenograft models (0.2 mg/mouse/day).[Cayman Chemical]
Uses
JK 184 is a small molecule antagonist of the Hedgehog (Hh) signaling pathway.