N-Boc-5-methoxyindole
N-BOC-5-METHOXYINDOLE · 1-Boc-5-methoxyindole · 1-Boc-5-methoxy-1H-indole · 5-Methoxy-1H-indole, N-BOC protected · 5-Methoxy-1H-indole,N-BOCprotected98% · N-(tert-Butoxycarbonyl)-5-methoxyindole · 5-Methoxy-1H-indole, N-BOC protected 98% · tert-butyl 5-methoxyindole-1-carboxylate
Identifiers & Physical Properties
| CAS No. | 99275-47-5 |
|---|---|
| Molecular formula | C14H17NO3 |
| Average molar mass | 247.29 g/mol |
| Monoisotopic mass | 247.1208434 g/mol |
| SMILES | COc1ccc2c(ccn2C(=O)OC(C)(C)C)c1 |
| InChIKey | LPSLGTZFBDZNEK-UHFFFAOYSA-N |
| PubChem CID | 11831752 |
| EC No. | 624-821-4 |
| DTXSID | DTXSID00474161 |
Chemical & Physical Properties
| XLogP | 3.2 |
|---|---|
| Topological polar surface area | 40.5 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 3 |
| Heavy atoms | 18 |
| Formal charge | 0 |
| Complexity | 311 |
| Melting point | 75-79 °C |
| Boiling point | 357.3±34.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| Storage conditions | Inert atmosphere,2-8°C |
| Physical state | solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C14H17NO3/c1-14(2,3)18-13(16)15-8-7-10-9-11(17-4)5-6-12(10)15/h5-9H,1-4H3 |
| InChIKey | LPSLGTZFBDZNEK-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C2=C(C=C(OC)C=C2)C=C1 |
| CAS DataBase Reference | 99275-47-5(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS06 |
| Signal word | Danger |
| GHS hazard statements | H301-H319 |
| GHS precautionary statements | P301+P310+P330-P305+P351+P338 |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard symbols | Xi,Xn |
| Risk statements (R) | 22-36 |
| Safety statements (S) | 26 |
| UN transport number | UN 2811 6.1/PG 3 |
| Water hazard class (WGK) | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| Storage class | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Hazard class | Acute Tox. 3 OralEye Irrit. 2 |
Safety & Regulations
| GHS classification | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P316, P305+P351+P338, P321, P330, P337+P317, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Water hazard class (WGK) | 3 |
| UN transport number | UN 2811 6.1/PG 3 |
| Risk statements (R) | 22-36 |
| Signal word | Danger |
| GHS pictogram | GHS06 |
| Hazard symbols | Xi,Xn |
| hazard_note | Harmful/Irritant/Keep Cold |
| Safety statements (S) | 26 |
| Storage class | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| GHS hazard statements | H301-H319 |
| Hazard class | Acute Tox. 3 OralEye Irrit. 2 |
| GHS precautionary statements | P301+P310+P330-P305+P351+P338 |
Applications & Uses
Uses
Reactant for preparation of:• ;Asymmetric intramolecular Friedel-Crafts alkylation reaction1• ;Palladium-catalyzed carboaminoxylations with arylboronic acids and TEMPO catalyst2• ;Fluorescent pyrimidopyrimidoindole nucleosides via Suzuki-Miyaura coupling reaction3• ;Novel conformationally restricted β- and γ-amino acids4• ;2-(Indolyl) borates, silanes, and silanols5• ;DNA minor groove alkylating agents as stable amine-based prodrugs designed for tumor-specific release6
Uses
Reactant for preparation of:Asymmetric intramolecular Friedel-Crafts alkylation reactionPalladium-catalyzed carboaminoxylations with arylboronic acids and TEMPO catalystFluorescent pyrimidopyrimidoindole nucleosides via Suzuki-Miyaura coupling reactionNovel conformationally restricted β- and γ-amino acids2-(Indolyl) borates, silanes, and silanolsDNA minor groove alkylating agents as stable amine-based prodrugs designed for tumor-specific release