HuagongsheHuagongshe Chemistry Print Report · For research reference only
tert-Butyl((5-iodopentyl)oxy)dimethylsilane
5-(tert-Butyldimethylsilyloxy)pentyliodide · tert-Butyl[(5-iodopentyl)oxy]dimethylsilane · (1,1-Dimethylethyl)[(5-iodopentyl)oxy]dimethylsilane · Silane, (1,1-dimethylethyl)[(5-iodopentyl)oxy]dimethyl- · (1,1-Dimethylethyl)[(5-iodopentyl)oxy]dimethylsilane - [D8485]
Identifiers & Physical Properties
| CAS No. | 85514-45-0 |
|---|---|
| Molecular formula | C11H25IOSi |
| Average molar mass | 328.3 g/mol |
| Monoisotopic mass | 328.07194 g/mol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCI |
| InChIKey | BLWAIPMPRTUOSB-UHFFFAOYSA-N |
| PubChem CID | 14567006 |
| DTXSID | DTXSID30561715 |
Chemical & Physical Properties
| Topological polar surface area | 9.2 |
|---|---|
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 1 |
| Rotatable bonds | 7 |
| Heavy atoms | 14 |
| Formal charge | 0 |
| Complexity | 152 |
| Boiling point | 125 °C(Press: 0.6 Torr) |
| Density | 1.211±0.06 g/cm3(Predicted) |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H302-H315-H319-H335 |
| GHS precautionary statements | P261-P302+P352-P304+P340-P305+P351+P338 |
Safety & Regulations
| Signal word | Warning |
|---|---|
| GHS pictogram | GHS07 |
| GHS hazard statements | H302-H315-H319-H335 |
| GHS precautionary statements | P261-P302+P352-P304+P340-P305+P351+P338 |
Applications & Uses
Uses
tert-Butyl((5-iodopentyl)oxy)dimethylsilane is a silane compound with a terminal iodine group. The trimethylsilane is commonly used for surface modifications. The iodine (I) is a very good leaving group for nucleophilic substitution reactions.