HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 154734412Generated: October 31, 2026
N-{1-[(6-Chloro-3-pyridinyl)methyl]-2(1H)-pyridinylidene}-2,2,2-trifluoroacetamide mixt. with (1E)-N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide
https://huagongshe.com/en/chemical/154734412
Identifiers & Physical Properties
| CAS No. | 2102726-71-4 |
|---|
| Molecular formula | C23H20Cl2F3N7O |
|---|
| Average molar mass | 538.3 g/mol |
|---|
| Monoisotopic mass | 537.1058482 g/mol |
|---|
| SMILES | CC(=NC#N)N(C)Cc1ccc(Cl)nc1.O=C(N=c1ccccn1Cc1ccc(Cl)nc1)C(F)(F)F |
|---|
| InChIKey | YOWYXSVPJRWNTD-UHFFFAOYSA-N |
|---|
| PubChem CID | 154734412 |
|---|
| DTXSID | DTXSID601015149 |
|---|
Chemical & Physical Properties
| Topological polar surface area | 97.8 |
|---|
| Hydrogen bond donors | 0 |
|---|
| Hydrogen bond acceptors | 8 |
|---|
| Rotatable bonds | 5 |
|---|
| Heavy atoms | 36 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 768 |
|---|
![N-{1-[(6-Chloro-3-pyridinyl)methyl]-2(1H)-pyridinylidene}-2,2,2-trifluoroacetamide mixt. with (1E)-N-[(6-Chloro-3-pyridinyl)methyl]-N'-cyano-N-methylethanimidamide molecular structure](/img/chemical/154734412.png)