HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 16194574Generated: November 3, 2026
N-(2-(4-ethylpiperazin-1-yl)-2-(pyridin-3-yl)ethyl)thiophene-2-sulfonamide
https://huagongshe.com/en/chemical/16194574
Identifiers & Physical Properties
| CAS No. | 863558-54-7 |
|---|
| Molecular formula | C17H24N4O2S2 |
|---|
| Average molar mass | 380.5 g/mol |
|---|
| Monoisotopic mass | 380.13406837 g/mol |
|---|
| SMILES | CCN1CCN(C(CNS(=O)(=O)c2cccs2)c2cccnc2)CC1 |
|---|
| InChIKey | ROFVIGVNDRSCAJ-UHFFFAOYSA-N |
|---|
| PubChem CID | 16194574 |
|---|
| ChEMBL | CHEMBL2142921 |
|---|
| DTXSID | DTXSID701332992 |
|---|
Chemical & Physical Properties
| XLogP | 1.6 |
|---|
| Topological polar surface area | 102 |
|---|
| Hydrogen bond donors | 1 |
|---|
| Hydrogen bond acceptors | 7 |
|---|
| Rotatable bonds | 7 |
|---|
| Heavy atoms | 25 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 503 |
|---|
| Solubility | 49.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
