HuagongsheHuagongshe Chemistry Print Report · For research reference only
Ethylamine, 2-(1,4-benzodioxan-6-yloxy)-N,N-dimethyl-, hydrochloride
2-(2,3-Dihydro-1,4-benzodioxin-6-yloxy)-N,N-dimethylethanamine
Identifiers & Physical Properties
| CAS No. | 3308-62-1 |
|---|---|
| Molecular formula | C12H18ClNO3 |
| Average molar mass | 259.73 g/mol |
| Monoisotopic mass | 259.0975211 g/mol |
| SMILES | C[NH+](C)CCOc1ccc2c(c1)OCCO2.[Cl-] |
| InChIKey | VRCSNYKNBODDIM-UHFFFAOYSA-N |
| PubChem CID | 18708 |
Chemical & Physical Properties
| Topological polar surface area | 32.1 |
|---|---|
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 4 |
| Heavy atoms | 17 |
| Formal charge | 0 |
| Complexity | 210 |
| Storage conditions | -20°C |
| Physical state | solution |
| InChI | 1S/C12H17NO3.ClH/c1-13(2)5-6-14-10-3-4-11-12(9-10)16-8-7-15-11/h3-4,9H,5-8H2,1-2H31H |
| InChIKey | VRCSNYKNBODDIM-UHFFFAOYSA-N |
| SMILES | Cl.CN(C)CCOc1ccc2OCCOc2c1 |
| UNSPSC Code | 12352204 |
| NACRES | NA.54 |
| Storage class | 10 - Combustible liquids |
Safety & Regulations
| Storage class | 10 - Combustible liquids |
|---|
Applications & Uses
Uses
p30 is an endogenous truncated form of p39 th at associates with Cdk5 to form Nclk, which regulates neurotransmission, axon guidance, central nervous system (CNS) architecture, and pathogenesis. Therefore, p30 is useful in studying neurodegenerative diseases such as Alzheimer′s, Amyotrophic Lateral Sclerosis, and Parkinson′s Disease.