HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 2139657Generated: November 4, 2026
N-(1,3-dioxoisoindol-2-yl)-2-(5-methyl-2-propan-2-ylphenoxy)acetamide
https://huagongshe.com/en/chemical/2139657
Identifiers & Physical Properties
| CAS No. | 458526-45-9 |
|---|
| Molecular formula | C20H20N2O4 |
|---|
| Average molar mass | 352.4 g/mol |
|---|
| Monoisotopic mass | 352.14230712 g/mol |
|---|
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NN2C(=O)c3ccccc3C2=O)c1 |
|---|
| InChIKey | XTSLVXXDDAIWGQ-UHFFFAOYSA-N |
|---|
| PubChem CID | 2139657 |
|---|
| ChEMBL | CHEMBL1348731 |
|---|
| DTXSID | DTXSID501321016 |
|---|
Chemical & Physical Properties
| XLogP | 3.6 |
|---|
| Topological polar surface area | 75.7 |
|---|
| Hydrogen bond donors | 1 |
|---|
| Hydrogen bond acceptors | 4 |
|---|
| Rotatable bonds | 4 |
|---|
| Heavy atoms | 26 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 538 |
|---|
| Solubility | 20.2 [ug/mL] (The mean of the results at pH 7.4) |
|---|
