10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione
Boldione · 1,4-ANDROSTADIENEDIONE · ANDROSTADIENEDIONE · 1,4-ANDROSTADIENE-3,17-DIONE · 10,13-DIMETHYL-7,8,9,11,12,14,15,16-OCTAHYDRO-6H-CYCLOPENTA[A]PHENANTHRENE-3,17-DIONE · 10,13-DIMETHYL-7,8,9,10,11,12,13,14,15,16-DECAHYDRO-3H-CYCLOPENTA[A]PHENANTHRENE-3,17(6H)-DIONE · (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione · (8R,9S,10R,13S,14S)-10,13-dimethyl-7,8,9,10,11,12,13,14,15,16-decahydro-3H-cyclopenta[a]phenanthrene-3,17(6H)-dione
![10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione molecular structure](/img/chemical/2192.png)
Identifiers & Physical Properties
| CAS No. | 897-06-3 |
|---|---|
| Molecular formula | C19H24O2 |
| Average molar mass | 284.4 g/mol |
| SMILES | CC12C=CC(=O)C=C1CCC1C2CCC2(C)C(=O)CCC12 |
| InChIKey | LUJVUUWNAPIQQI-UHFFFAOYSA-N |
| PubChem CID | 2192 |
| ChEMBL | CHEMBL8512 |
| ChEBI | CHEBI:182567 |
Chemical & Physical Properties
| XLogP | 3 |
|---|---|
| Topological polar surface area | 34.1 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 21 |
| Formal charge | 0 |
| Complexity | 584 |
| Melting point | 138-139 °C(lit.) |
| Boiling point | 434.2±45.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| Vapor pressure | 0Pa at 20℃ |
| Storage conditions | Refrigerator |
| Solubility | DMF: 50 mg/mlDMF:PBS(pH 7.2)(1:1): 0.5 mg/mlDMSO: 30 mg/mlEthanol: 5 mg/ml430mg/L at 20℃ |
| Physical state | A crystalline solid |
| Major applications | pharmaceutical |
| InChI | 1S/C19H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | LUJVUUWNAPIQQI-QAGGRKNESA-N |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]4(C)C(=O)CC[C@@]24[H] |
| LogP (partition coefficient) | 2.2 at 25℃ |
| CAS DataBase Reference | 897-06-3(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | 2166Q8568W |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
| GHS pictogram | GHS08,GHS09 |
| Signal word | Danger |
| GHS hazard statements | H411-H362-H351-H360 |
| GHS precautionary statements | P201-P260-P263-P264-P270-P308+P313-P201-P202-P281-P308+P313-P405-P501 |
| Hazard symbols | Xn |
| Risk statements (R) | 20/21/22-36/37/38 |
| Safety statements (S) | 26-36 |
| Water hazard class (WGK) | 3 |
| RTECS number | BV7988000 |
| Customs code | 29372900 |
| Storage class | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| Hazard class | Aquatic Chronic 2Carc. 2Lact.Repr. 1B |
| DEA Controlled Substances | CSCN: 4000CAS SCH: ⅢNARC: N |
| REACH registrations | Active |
Safety & Regulations
| Water hazard class (WGK) | 3 |
|---|---|
| RTECS number | BV7988000 |
| Customs code | 29372900 |
| Risk statements (R) | 20/21/22-36/37/38 |
| Signal word | Danger |
| GHS pictogram | GHS08,GHS09 |
| Hazard symbols | Xn |
| Safety statements (S) | 26-36 |
| Storage class | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
| GHS hazard statements | H411-H362-H351-H360 |
| REACH registrations | Active |
| Hazard class | Aquatic Chronic 2Carc. 2Lact.Repr. 1B |
| GHS precautionary statements | P201-P260-P263-P264-P270-P308+P313-P201-P202-P281-P308+P313-P405-P501 |
| DEA Controlled Substances | CSCN: 4000CAS SCH: ⅢNARC: N |
Applications & Uses
Description
Androsta-1,4-diene-3,17-dione (Item No. 24081) is an analytical reference standard categorized as an anabolic androgenic steroid. Androsta-1,4-diene-3,17-dione is a precursor in the synthesis of boldenone and has been used to enhance athletic performance. Androsta-1,4-diene-3,17-dione is regulated as a Schedule III compound in the United States. This product is intended for research and forensic applications.
Uses
Boldenone related steroid; anabolic androgenic steroid