HuagongsheHuagongshe Chemistry Print Report · For research reference only
6-Methylquinoxaline
Quinoxaline, 6-methyl- · 6-METHYLQUINOXALINE · 6-METHYLQUINOXALINE 99% · 6-Methylquinoxaline , 97+%
Identifiers & Physical Properties
| CAS No. | 6344-72-5 |
|---|---|
| Molecular formula | C9H8N2 |
| Average molar mass | 144.17 g/mol |
| Monoisotopic mass | 144.06874826 g/mol |
| SMILES | Cc1ccc2nccnc2c1 |
| InChIKey | OSRARURJYPOUOV-UHFFFAOYSA-N |
| PubChem CID | 242567 |
| ChEMBL | CHEMBL1885120 |
| ChEBI | CHEBI:194888 |
| EC No. | 670-336-6 |
| DTXSID | DTXSID00287490 |
Chemical & Physical Properties
| XLogP | 1.7 |
|---|---|
| Topological polar surface area | 25.8 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 136 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| Melting point | 218.5°C |
| Boiling point | 244-245°C |
| Density | 1.1164 |
| Refractive index | 1.6190 |
| Flash point | 244-245°C |
| Storage conditions | Sealed in dry,Room Temperature |
| pKa (acidity coefficient) | 1.40±0.30(Predicted) |
| Appearance | Light yellow to brown Liquid |
| BRN | 113371 |
| InChI | InChI=1S/C9H8N2/c1-7-2-3-8-9(6-7)11-5-4-10-8/h2-6H,1H3 |
| InChIKey | OSRARURJYPOUOV-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C)=CC=2)N=CC=1 |
| LogP (partition coefficient) | 1.872 (est) |
| CAS DataBase Reference | 6344-72-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoxaline, 6-methyl-(6344-72-5) |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319 |
| GHS precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard symbols | Xn,Xi,C,F |
| Risk statements (R) | 22-36/37/38-34-11 |
| Safety statements (S) | 23-26-36/37/39-45-16 |
| Hazard class | IRRITANT |
| Customs code | 2933998090 |
Safety & Regulations
| GHS classification | WarningH302 (16.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatory information | Chemical: Quinoxaline, 6-methyl-Quinoxaline, 6-methyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (16.7%) |
| Customs code | 2933998090 |
| Risk statements (R) | 22-36/37/38-34-11 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xn,Xi,C,F |
| Safety statements (S) | 23-26-36/37/39-45-16 |
| Hazard class | IRRITANT |
| GHS hazard statements | H315-H319 |
| GHS precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
Applications & Uses
Uses
6-Methylquinoxaline (CAS# 6344-72-5) can be used as a conductive roller for electrophotographic apparatus. It has also be known for its sequential synthesis, olfactory properties, and biological activity.