HuagongsheHuagongshe Chemistry Print Report · For research reference only
4,4'-Sulfonylbis(2-methylphenol)
Topoisomerase IIα-IN-9 · 4,4'-Sulfonylbis(2-methylphenol) · Phenol, 4,4'-sulfonylbis[2-methyl- · 3,3'-DIMETHYL-4,4'-DIHYDROXYDIPHENYL SULFONE · 4,4'-Dihydroxy-3,3'-dimethyl[sulfonylbisbenzene]
Identifiers & Physical Properties
| CAS No. | 16346-97-7 |
|---|---|
| Molecular formula | C14H14O4S |
| Average molar mass | 278.33 g/mol |
| Monoisotopic mass | 278.0612801 g/mol |
| SMILES | Cc1cc(S(=O)(=O)c2ccc(O)c(C)c2)ccc1O |
| InChIKey | XTEGBRKTHOUETR-UHFFFAOYSA-N |
| PubChem CID | 257513 |
| EC No. | 629-429-7 |
| DTXSID | DTXSID50292796 |
Chemical & Physical Properties
| XLogP | 2.7 |
|---|---|
| Topological polar surface area | 83 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 2 |
| Heavy atoms | 19 |
| Formal charge | 0 |
| Complexity | 368 |
| Melting point | 273-276 °C(lit.) |
| Boiling point | 518.8±50.0 °C(Predicted) |
| Density | 1.343±0.06 g/cm3(Predicted) |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| Physical state | Solid |
| pKa (acidity coefficient) | 7.25±0.20(Predicted) |
| Color | Pale Orange to Pale Red |
| InChI | 1S/C14H14O4S/c1-9-7-11(3-5-13(9)15)19(17,18)12-4-6-14(16)10(2)8-12/h3-8,15-16H,1-2H3 |
| InChIKey | XTEGBRKTHOUETR-UHFFFAOYSA-N |
| SMILES | Cc1cc(ccc1O)S(=O)(=O)c2ccc(O)c(C)c2 |
| UNSPSC Code | 12162002 |
| NACRES | NA.23 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 26-36 |
| Water hazard class (WGK) | 3 |
| Storage class | 11 - Combustible Solids |
| Hazard class | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Safety & Regulations
| GHS classification | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| Safety statements (S) | 26-36 |
| Storage class | 11 - Combustible Solids |
| Target organs | Respiratory system |
| GHS hazard statements | H315-H319-H335 |
| Hazard class | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
Topoisomerase IIα-IN-9 (NSC85582) is a bisphenol compound that has a moderate inhibitory effect on DNA topoisomerase Topoisomerase II (IC50: 571 μM). Topoisomerase IIα-IN-9 also exhibits a certain cell growth inhibitory effect, with IC50s of 117 μM and 218 μM for K562 and CHO, respectively[1].