HuagongsheHuagongshe Chemistry Print Report · For research reference only
6-Amino-4-pentan-3-yl-3-phenyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile
Deserpidine hydrochloride
![6-Amino-4-pentan-3-yl-3-phenyl-2,4-dihydropyrano[2,3-c]pyrazole-5-carbonitrile molecular structure](/img/chemical/2881140.png)
Identifiers & Physical Properties
| CAS No. | 6033-69-8 |
|---|---|
| Molecular formula | C18H20N4O |
| Average molar mass | 308.4 g/mol |
| Monoisotopic mass | 308.16371127 g/mol |
| SMILES | CCC(CC)C1C(C#N)=C(N)Oc2n[nH]c(-c3ccccc3)c21 |
| InChIKey | IPVCPNKDNPVCAK-UHFFFAOYSA-N |
| PubChem CID | 2881140 |
| ChEMBL | CHEMBL1520340 |
| DTXSID | DTXSID10387112 |
Chemical & Physical Properties
| XLogP | 4.3 |
|---|---|
| Topological polar surface area | 87.7 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 4 |
| Heavy atoms | 23 |
| Formal charge | 0 |
| Complexity | 498 |
| Melting point | 253-256 °C |
| FDA UNII | 6LPC48045D |
Applications & Uses
Uses
Deserpidine hydrochloride (Harmonyl hydrochloride) is an antihypertensive compound that competitively inhibits the activity of angiotensin converting enzyme (ACE). Deserpidine hydrochloride competes with angiotensin I for ACE, preventing the conversion of angiotensin I to angiotensin II, thereby lowering blood pressure. Deserpidine hydrochloride can also reduce angiotensin II-induced aldosterone secretion from the adrenal cortex[1].