HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 3691621Generated: November 4, 2026
N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-2-ethoxypyridine-3-carboxamide
https://huagongshe.com/en/chemical/3691621
Identifiers & Physical Properties
| CAS No. | 380471-44-3 |
|---|
| Molecular formula | C22H30N4O5S |
|---|
| Average molar mass | 462.6 g/mol |
|---|
| Monoisotopic mass | 462.19369124 g/mol |
|---|
| SMILES | CCOc1ncccc1C(=O)Nc1cc(S(=O)(=O)N(CC)CC)ccc1N1CCOCC1 |
|---|
| InChIKey | QKGIICDSOVBQSM-UHFFFAOYSA-N |
|---|
| PubChem CID | 3691621 |
|---|
| ChEMBL | CHEMBL1712729 |
|---|
| DTXSID | DTXSID401323538 |
|---|
Chemical & Physical Properties
| XLogP | 2 |
|---|
| Topological polar surface area | 109 |
|---|
| Hydrogen bond donors | 1 |
|---|
| Hydrogen bond acceptors | 8 |
|---|
| Rotatable bonds | 9 |
|---|
| Heavy atoms | 32 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 691 |
|---|
| Solubility | 6.5 [ug/mL] (The mean of the results at pH 7.4) |
|---|
![N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-2-ethoxypyridine-3-carboxamide molecular structure](/img/chemical/3691621.png)