HuagongsheHuagongshe Chemistry Print Report · For research reference only
7-[1-(4-Chlorophenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine
[1,2,4]Triazolo[1,5-a]pyrimidine, 7-[(1R)-1-(4-chlorophenoxy)ethyl]-
![7-[1-(4-Chlorophenoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine molecular structure](/img/chemical/3801739.png)
Identifiers & Physical Properties
| CAS No. | 165383-52-8 |
|---|---|
| Molecular formula | C13H11ClN4O |
| Average molar mass | 274.7 g/mol |
| Monoisotopic mass | 274.06213865 g/mol |
| SMILES | CC(Oc1ccc(Cl)cc1)c1ccnc2ncnn12 |
| InChIKey | FCEPUTGEUCVRRI-UHFFFAOYSA-N |
| PubChem CID | 3801739 |
| ChEMBL | CHEMBL4303701 |
| EC No. | 605-405-1 |
| DTXSID | DTXSID60396633 |
Chemical & Physical Properties
| XLogP | 2.6 |
|---|---|
| Topological polar surface area | 52.3 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 3 |
| Heavy atoms | 19 |
| Formal charge | 0 |
| Complexity | 298 |
Applications & Uses
Description
BTS-72664 is a novel CNS drug with potential anticonvulsant, neuroprotective, and antimigraine properties.