Keto-pantoyllactone
DIHYDRO-4 · 4-DIMETHYL-2 · 3-FURANDIONE · Ketopantolactone · keto-pantoyllactone · 2-dehydropantolactone · alpha-Ketopantolactone · Dexpanthenol iMpurity D
Identifiers & Physical Properties
| CAS No. | 13031-04-4 |
|---|---|
| Molecular formula | C6H8O3 |
| Average molar mass | 128.13 g/mol |
| Monoisotopic mass | 128.04734411 g/mol |
| SMILES | CC1(C)COC(=O)C1=O |
| InChIKey | HRTOQFBQOFIFEE-UHFFFAOYSA-N |
| PubChem CID | 39 |
| ChEBI | CHEBI:18395 |
| EC No. | 235-891-7 |
| DTXSID | DTXSID30156448 |
Chemical & Physical Properties
| XLogP | 0.6 |
|---|---|
| Topological polar surface area | 43.4 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 0 |
| Heavy atoms | 9 |
| Formal charge | 0 |
| Complexity | 169 |
| Melting point | 67-69 °C (lit.) |
| Boiling point | 125-126℃ (15 Torr) |
| Density | 1.152±0.06 g/cm3(Predicted) |
| Storage conditions | under inert gas (nitrogen or Argon) at 2-8°C |
| Solubility | dichloromethane: soluble25mg/mL, clear, colorless to yellow |
| Physical state | Solid |
| Color | Pale Beige |
| InChI | InChI=1S/C6H8O3/c1-6(2)3-9-5(8)4(6)7/h3H2,1-2H3 |
| InChIKey | HRTOQFBQOFIFEE-UHFFFAOYSA-N |
| SMILES | O1CC(C)(C)C(=O)C1=O |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H335-H319-H315 |
| GHS precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Personal protective equipment (PPE) | Eyeshields, Gloves, type N95 (US) |
| Water hazard class (WGK) | 3 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| Personal protective equipment (PPE) | Eyeshields, Gloves, type N95 (US) |
|---|---|
| Water hazard class (WGK) | 3 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Storage class | 11 - Combustible Solids |
| GHS hazard statements | H335-H319-H315 |
| GHS precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
Applications & Uses
Uses
Dihydro-4,4-dimethyl-2,3-furandione is a heterocyclic organic compound, mainly used as a pharmaceutical intermediate.
Uses
Dihydro-4,4-dimethyl-2,3-furandione is an activated keto compound and its enantioselective hydrogenation was reported. Neutral Rhodium (I) aminophosphine-phosphinite complex calatyzed asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione was reported. Asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione gives D-(-)-pantoyl lactone, a key intermediate in the synthesis of pantothenic acid.
General Description
Dihydro-4,4-dimethyl-2,3-furandione is an activated keto compound and its enantioselective hydrogenation was reported. Neutral Rhodium (I) aminophosphine-phosphinite complex calatyzed asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione was reported. Asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione gives D-(-)-pantoyl lactone, a key intermediate in the synthesis of pantothenic acid.