HuagongsheHuagongshe Chemistry Print Report · For research reference only
Nanaomycin
Nanaomycin · os-3966-a · rosanomycina · heptauromycin · (1s-e)-10-dioxo · 1h-naphtho(2,3-c)pyran-3-aceticacid,3,4,5,10-tetrahydro-9-hydroxy-1-methyl-5, · (1S)-3,4,5,10-Tetrahydro-9-hydroxy-1-methyl-5,10-dioxo-1H-naphtho[2,3-c]pyran-3β-acetic acid · (1S,3R)-3,4,5,10-Tetrahydro-9-hydroxy-1-methyl-5,10-dioxo-1H-naphtho[2,3-c]pyran-3-acetic acid
Identifiers & Physical Properties
| CAS No. | 52934-83-5 |
|---|---|
| Molecular formula | C16H14O6 |
| Average molar mass | 302.28 g/mol |
| Monoisotopic mass | 302.07903816 g/mol |
| SMILES | CC1OC(CC(=O)O)CC2=C1C(=O)c1c(O)cccc1C2=O |
| InChIKey | ZCJHPTKRISJQTN-UHFFFAOYSA-N |
| PubChem CID | 40586 |
| ChEMBL | CHEMBL1212972 |
| ChEBI | CHEBI:193279 |
Chemical & Physical Properties
| XLogP | 1.3 |
|---|---|
| Topological polar surface area | 101 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 6 |
| Rotatable bonds | 2 |
| Heavy atoms | 22 |
| Formal charge | 0 |
| Complexity | 563 |
| Melting point | 179°C |
| Boiling point | 363.32°C (rough estimate) |
| Density | 1.2514 (rough estimate) |
| Refractive index | 1.4600 (estimate) |
| Storage conditions | −20°C |
| Solubility | insoluble in H2O≥15.1 mg/mL in DMSO≥31.07 mg/mL in EtOH with ultrasonic |
| Physical state | solid |
| Color | Yellow to orange |
| FDA UNII | 8XBV72641V |
| GHS pictogram | GHS06 |
| Signal word | Danger |
| GHS hazard statements | H310-H301 |
| GHS precautionary statements | P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| Hazard symbols | T |
| Risk statements (R) | 22-24 |
| Safety statements (S) | 36/37-45 |
| UN transport number | UN 2811 6.1/PG 3 |
| Water hazard class (WGK) | 3 |
| RTECS number | QL6127000 |
Safety & Regulations
| Water hazard class (WGK) | 3 |
|---|---|
| RTECS number | QL6127000 |
| UN transport number | UN 2811 6.1/PG 3 |
| Risk statements (R) | 22-24 |
| Signal word | Danger |
| GHS pictogram | GHS06 |
| Hazard symbols | T |
| Safety statements (S) | 36/37-45 |
| GHS hazard statements | H310-H301 |
| GHS precautionary statements | P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
Applications & Uses
Uses
Nanaomycin A is the first selective DNMT3B inhibitor with an IC50 of 500 nM. Nanaomycin A, a quinone antibiotics, reactivates silenced tumor suppressor genes in human cancer cells[1]. Nanaomycin A inhibits in vitro growth of the human malaria parasite Plasmodium falciparum with an IC80 value of 33.1 nM[2].