HuagongsheHuagongshe Chemistry Print Report · For research reference only
HCID 4791237Generated: November 3, 2026
N-(4-methyl-1,3-thiazol-2-yl)-5-(phenoxymethyl)furan-2-carboxamide
https://huagongshe.com/en/chemical/4791237
Identifiers & Physical Properties
| CAS No. | 853726-08-6 |
|---|
| Molecular formula | C16H14N2O3S |
|---|
| Average molar mass | 314.4 g/mol |
|---|
| Monoisotopic mass | 314.07251349 g/mol |
|---|
| SMILES | Cc1csc(NC(=O)c2ccc(COc3ccccc3)o2)n1 |
|---|
| InChIKey | DLCCNAAUZWNBBD-UHFFFAOYSA-N |
|---|
| PubChem CID | 4791237 |
|---|
| ChEMBL | CHEMBL1445504 |
|---|
| DTXSID | DTXSID801322956 |
|---|
Chemical & Physical Properties
| XLogP | 3.4 |
|---|
| Topological polar surface area | 92.6 |
|---|
| Hydrogen bond donors | 1 |
|---|
| Hydrogen bond acceptors | 5 |
|---|
| Rotatable bonds | 5 |
|---|
| Heavy atoms | 22 |
|---|
| Formal charge | 0 |
|---|
| Complexity | 376 |
|---|
| Solubility | 3.3 [ug/mL] (The mean of the results at pH 7.4) |
|---|
